Machine Learning Decision Tree Classifier with Gini Algorithm written from scratch
# for analyzing data
import pandas as pd
import numpy as np
import seaborn as sbn
from sklearn.model_selection import train_test_split
from sklearn import metrics
# for plots
import matplotlib.pyplot as plt
from itertools import cycle
from sklearn.metrics import roc_curve, auc
from sklearn.preprocessing import label_binarize
# for training, our own implementation
from dt import DecisionTreeClassifieriris = pd.read_csv('Iris.csv')
# istenildigi gibi tur stringlerini sayilara ceviriyorum
iris = iris.drop(columns='Id')
species = {'Iris-setosa': 0, 'Iris-versicolor': 1, 'Iris-virginica': 2}
iris['Species'] = [species[item] for item in iris['Species']]display(iris)| SepalLengthCm | SepalWidthCm | PetalLengthCm | PetalWidthCm | Species | |
|---|---|---|---|---|---|
| 0 | 5.1 | 3.5 | 1.4 | 0.2 | 0 |
| 1 | 4.9 | 3.0 | 1.4 | 0.2 | 0 |
| 2 | 4.7 | 3.2 | 1.3 | 0.2 | 0 |
| 3 | 4.6 | 3.1 | 1.5 | 0.2 | 0 |
| 4 | 5.0 | 3.6 | 1.4 | 0.2 | 0 |
| ... | ... | ... | ... | ... | ... |
| 145 | 6.7 | 3.0 | 5.2 | 2.3 | 2 |
| 146 | 6.3 | 2.5 | 5.0 | 1.9 | 2 |
| 147 | 6.5 | 3.0 | 5.2 | 2.0 | 2 |
| 148 | 6.2 | 3.4 | 5.4 | 2.3 | 2 |
| 149 | 5.9 | 3.0 | 5.1 | 1.8 | 2 |
150 rows × 5 columns
Özet olarak 150 satirlik, standart sapması yani farklılığı en çok SepalWidthCm özniteliğinde olan bir veri setimiz var.
sl = iris['SepalLengthCm'].describe()
sw = iris['SepalWidthCm'].describe()
pl = iris['PetalLengthCm'].describe()
pw = iris['PetalWidthCm'].describe()
print(sl)
print(sw)
print(pl)
print(pw)count 150.000000
mean 5.843333
std 0.828066
min 4.300000
25% 5.100000
50% 5.800000
75% 6.400000
max 7.900000
Name: SepalLengthCm, dtype: float64
count 150.000000
mean 3.054000
std 0.433594
min 2.000000
25% 2.800000
50% 3.000000
75% 3.300000
max 4.400000
Name: SepalWidthCm, dtype: float64
count 150.000000
mean 3.758667
std 1.764420
min 1.000000
25% 1.600000
50% 4.350000
75% 5.100000
max 6.900000
Name: PetalLengthCm, dtype: float64
count 150.000000
mean 1.198667
std 0.763161
min 0.100000
25% 0.300000
50% 1.300000
75% 1.800000
max 2.500000
Name: PetalWidthCm, dtype: float64
3 tane tekrarlayan verimiz var ama tekrarları çıkarmamız iyi olur mu bilmek için bir de veri setindeki tür sayılarının dengesine bakmalıyız.
display(iris[iris.duplicated()])
display(iris.duplicated().sum())| SepalLengthCm | SepalWidthCm | PetalLengthCm | PetalWidthCm | Species | |
|---|---|---|---|---|---|
| 34 | 4.9 | 3.1 | 1.5 | 0.1 | 0 |
| 37 | 4.9 | 3.1 | 1.5 | 0.1 | 0 |
| 142 | 5.8 | 2.7 | 5.1 | 1.9 | 2 |
3
Aşağıdaki grafiğe baktığımızda tekrarlayan verileri çıkarmanın iyi bir fikir olmadığını görüyoruz çünkü tür sayıları eşit, yani veriler dengeli şekilde dağılmış durumda.
plt.title('Count of Species')
sbn.countplot(iris['Species'])
plt.show()/Users/shc/anaconda3/lib/python3.9/site-packages/seaborn/_decorators.py:36: FutureWarning: Pass the following variable as a keyword arg: x. From version 0.12, the only valid positional argument will be `data`, and passing other arguments without an explicit keyword will result in an error or misinterpretation.
warnings.warn(
Aşağıda görüleceği üzere veri setinden temizlememiz gereken null değerler yok.
print(iris.isnull().sum(axis = 0))SepalLengthCm 0
SepalWidthCm 0
PetalLengthCm 0
PetalWidthCm 0
Species 0
dtype: int64
Aşağıdaki grafiklere baktığımızda, farklı öznitelikler için verilerin birbirine göre uzayda nasıl dağıldığını görebiliyoruz ve bu da hangi özniteliği kullanmamız gerektiği konusunda bize kabaca fikir verebilir. Görüleceği üzere, örnek olarak PetalWidthCm ile SepalWidthCm özniteliklerini kullanmak daha iyi bir ayrım yapmamızı sağlayabilir.
sbn.set_style('whitegrid')
sbn.pairplot(iris, hue='Species', height=3)
plt.show()Yine burada özniteliklerin korelasyonlarına bakarak hangilerini kullanmanın daha iyi olabileceği çıkarımına varabiliriz. Bizim için önemli olan veri setini olabildiğince ayrıştırmak olduğu için korelasyonu yani ilişkisi en az olanlara bakmamız gerekir. Yukarıda pair-plot üzerinden verdiğimiz PetalWidthCm ve SepalWidthCm öznitelikleri yine burada da -0.42 korelasyonla iyi seçenek olarak duruyor.
cm = iris.corr()
ft = cm.drop(columns=['SepalLengthCm', 'SepalWidthCm', 'PetalLengthCm', 'PetalWidthCm'])
ft = ft.drop(labels=['Species'])
sbn.set(font_scale=1.4)
sbn.heatmap(cm, annot=True, cmap=plt.cm.Reds)
plt.show()
sbn.set(font_scale=1.4)
sbn.heatmap(ft, annot=True, cmap=plt.cm.Reds)
plt.show()Veri setini eğitmek üzere, bu dokümanın sonunda ya da "dt.py" dosyasında bulabileceğiniz daha önceden oluşturduğumuz karar ağacı modelini, maksimum derinlik 5 olacak şekilde çağırıyoruz.
clf = DecisionTreeClassifier(max_depth=5)Veri setini karıştırıyoruz (shuffle) ve %80 eğitim, %20 test verisi olacak şekilde ayrıştırıyoruz.
X = iris.values.tolist()
y = []
for row in X:
y.append(int(row[4]))
del row[4]
X = pd.Series(X)
y = pd.Series(y)
X_train, X_test, y_train, y_test = train_test_split(X, y, test_size=0.2, shuffle=True)
X_train_list = X_train.values.tolist()
y_train_list = y_train.values.tolist()
X_test_list = X_test.values.tolist()
y_test_list = y_test.values.tolist()Veri setini oluşturmuş olduğumuz Gini Impurity algoritmasını kullanan model sayesinde eğitiyoruz.
clf.fit(X_train_list, y_train_list)Test verilerini tahmin ediyoruz ve beklenen değerlere benzer tahminler yaptığımızı görebiliyoruz ki bunları sonuçlar kısmında daha detaylı görebiliriz.
yhat = clf.predict(X_test_list)
print('Test Features Expected Classification')
print(y_test_list)
print('Prediction')
print(yhat)
print()
xhat = clf.predict(X_train_list)
print('Train Features Expected Classification')
print(y_train_list)
print('Prediction')
print(xhat)Test Features Expected Classification
[2, 2, 0, 2, 1, 0, 1, 1, 2, 2, 0, 2, 0, 0, 2, 2, 1, 0, 0, 1, 0, 2, 2, 1, 2, 0, 2, 0, 1, 2]
Prediction
[2, 2, 0, 2, 1, 0, 1, 1, 2, 2, 0, 2, 0, 0, 2, 2, 1, 0, 0, 1, 0, 2, 2, 1, 2, 0, 2, 0, 1, 2]
Train Features Expected Classification
[2, 2, 0, 0, 1, 0, 2, 1, 1, 1, 1, 0, 2, 1, 0, 1, 1, 1, 0, 0, 0, 2, 2, 2, 2, 0, 0, 0, 2, 0, 0, 0, 2, 0, 0, 1, 1, 2, 0, 1, 2, 0, 0, 2, 1, 2, 2, 0, 0, 1, 2, 1, 1, 1, 1, 2, 1, 2, 0, 0, 1, 2, 2, 1, 1, 0, 0, 2, 0, 0, 2, 0, 1, 1, 0, 1, 2, 2, 1, 2, 2, 0, 0, 2, 0, 1, 2, 2, 0, 1, 2, 0, 1, 2, 1, 0, 2, 0, 1, 1, 1, 1, 2, 1, 1, 0, 2, 1, 1, 0, 2, 1, 0, 2, 1, 0, 1, 2, 1, 1]
Prediction
[2, 2, 0, 0, 2, 0, 2, 2, 1, 1, 1, 2, 2, 1, 0, 1, 1, 1, 0, 0, 0, 2, 2, 1, 2, 0, 0, 0, 2, 0, 1, 0, 2, 0, 0, 1, 1, 2, 0, 1, 2, 0, 0, 2, 1, 2, 2, 0, 0, 1, 2, 1, 1, 1, 1, 2, 1, 2, 0, 0, 1, 2, 2, 1, 2, 0, 0, 2, 0, 0, 2, 0, 1, 1, 0, 1, 2, 2, 1, 2, 2, 0, 0, 1, 0, 1, 2, 2, 0, 1, 2, 0, 1, 2, 1, 0, 2, 0, 1, 1, 1, 1, 2, 1, 1, 0, 2, 1, 1, 0, 2, 1, 0, 2, 1, 0, 1, 2, 1, 1]
Aşağıda test değerleri için elde etmiş olduğumuz Confusion Matrix görülebilir. Bu matriste değerler ne kadar orta çaprazda toplanırsa o kadar doğru tahmin yaptığımızı gösteriyor ve bakıldığında, köşelerin 0 ya da 0'a çok yakın değerler olduğu ve bu da uygulamış olduğumuz karar ağacı algoritmasının test verileri için gayet iyi çalıştığını gösteriyor.
y_pred2 = pd.Series(yhat)
y_test2 = pd.Series(y_test_list)
mt = metrics.confusion_matrix(y_test2, y_pred2)
df_cm = pd.DataFrame(mt, range(3), range(3))
sbn.set(font_scale=1.4)
sbn.heatmap(df_cm, annot=True, annot_kws={'size': 16})
plt.show()Aşağıda train değerleri için elde etmiş olduğumuz Confusion Matrix görülebilir. Bakıldığında, köşelerin 0 ya da 0'a çok yakın değerler olduğu ve bu da uygulamış olduğumuz karar ağacı algoritmasının train verileri için gayet iyi çalıştığını gösteriyor.
x_pred2 = pd.Series(xhat)
x_test2 = pd.Series(y_train_list)
mt = metrics.confusion_matrix(x_test2, x_pred2)
df_cm = pd.DataFrame(mt, range(3), range(3))
sbn.set(font_scale=1.4)
sbn.heatmap(df_cm, annot=True, annot_kws={'size': 16})
plt.show()Aşağıda test ve train tahminleri için f1 skorlarının 1'e çok yakın olduğu görülüyor ve bu da yine tahminlerimizin büyük oranda doğru çıktığını doğruluyor.
f1 = metrics.f1_score(y_test2, y_pred2, average='weighted')
print('F1-Score Test:')
print(f1)
f2 = metrics.f1_score(x_test2, x_pred2, average='weighted')
print('F1-Score Train:')
print(f2)F1-Score Test:
1.0
F1-Score Train:
0.9421108861898336
Yine benzer şekilde, 1'e yakın accuracy değerleri tahminlerimizin doğruluğunun iyi olduğunu gösteriyor.
accuracy = metrics.accuracy_score(y_test2, y_pred2)
print('Accuracy Test:')
print(accuracy)
accuracy2 = metrics.accuracy_score(x_test2, x_pred2)
print('Accuracy Train:')
print(accuracy2)Accuracy Test:
1.0
Accuracy Train:
0.9416666666666667
Tahminlerin kesinliğinin iyi olduğunu da yine 1'e yakın değerlerden görebiliyoruz.
precision = metrics.precision_score(y_test2, y_pred2, average='weighted')
print('Precision Test:')
print(precision)
precision2 = metrics.precision_score(x_test2, x_pred2, average='weighted')
print('Precision Train:')
print(precision2)Precision Test:
1.0
Precision Train:
0.9433760683760684
Tahminlerin beklenen değerlerle ne kadar ilişkili olduğunu yine aşağıdaki 1'e yakın olan değerlerden görebiliyoruz.
recall = metrics.recall_score(y_test2, y_pred2, average='weighted')
print('Recall Test:')
print(recall)
recall2 = metrics.recall_score(x_test2, x_pred2, average='weighted')
print('Recall Train:')
print(recall2)Recall Test:
1.0
Recall Train:
0.9416666666666667
ROC eğrilerinin birbirlerine yakın olduğunu ve AUC değerlerinin de 1'e yakınsadığını görüyoruz ki bu da yine hem train hem test tahminlerimizin gayet iyi olduğunu gösteriyor.
y_testb = label_binarize(y_test2, classes=[0, 1, 2])
y_predb = label_binarize(y_pred2, classes=[0, 1, 2])
fpr = dict()
tpr = dict()
roc_auc = dict()
for i in range(3):
fpr[i], tpr[i], _ = roc_curve(y_testb[:, i], y_predb[:, i])
roc_auc[i] = auc(fpr[i], tpr[i])
all_fpr = np.unique(np.concatenate([fpr[i] for i in range(3)]))
mean_tpr = np.zeros_like(all_fpr)
for i in range(3):
mean_tpr = mean_tpr + np.interp(all_fpr, fpr[i], tpr[i])
mean_tpr = mean_tpr / 3
fpr['macro'] = all_fpr
tpr['macro'] = mean_tpr
roc_auc['macro'] = auc(fpr['macro'], tpr['macro'])
colors = cycle(['c', 'm', 'r'])
for i, color in zip(range(3), colors):
plt.plot(fpr[i], tpr[i], color=color, lw=2, label='ROC curve of class {0} (area = {1:0.2f})'.format(i, roc_auc[i]))
plt.plot([0,1], [0,1], 'k--', lw=2)
plt.xlim([0.0, 1.0])
plt.ylim([0.0, 1.05])
plt.xlabel('False Positive Rate')
plt.ylabel('True Positive Rate')
plt.title('ROC Curves for Test Data')
plt.legend(loc='lower right')
plt.show()
print('Macro Auc value:')
print(roc_auc['macro'])
x_testb = label_binarize(x_test2, classes=[0, 1, 2])
x_predb = label_binarize(x_pred2, classes=[0, 1, 2])
fpr = dict()
tpr = dict()
roc_auc = dict()
for i in range(3):
fpr[i], tpr[i], _ = roc_curve(x_testb[:, i], x_predb[:, i])
roc_auc[i] = auc(fpr[i], tpr[i])
all_fpr = np.unique(np.concatenate([fpr[i] for i in range(3)]))
mean_tpr = np.zeros_like(all_fpr)
for i in range(3):
mean_tpr += np.interp(all_fpr, fpr[i], tpr[i])
mean_tpr /= 3
fpr['macro'] = all_fpr
tpr['macro'] = mean_tpr
roc_auc['macro'] = auc(fpr['macro'], tpr['macro'])
for i, color in zip(range(3), colors):
plt.plot(fpr[i], tpr[i], color=color, lw=2, label='ROC curve of class {0} (area = {1:0.2f})'.format(i, roc_auc[i]))
plt.plot([0,1], [0,1], 'k--', lw=2)
plt.xlim([0.0, 1.0])
plt.ylim([0.0, 1.05])
plt.xlabel('False Positive Rate')
plt.ylabel('True Positive Rate')
plt.title('ROC Curves for Train Data')
plt.legend(loc='lower right')
plt.show()
print('Macro Auc value:')
print(roc_auc['macro'])Macro Auc value:
1.0
Macro Auc value:
0.9565041156733507
Tüm değerlendirmeler ve değişik ölçme yöntemlerine bağlı sonuçlar göz önüne alındığında uygulamış olduğumuz algoritmanın hem test hem train verileri için iyi tahmin yaptığını ve ayrıca test tahminlerinin, train tahminlerinden uzak olmadığını hatta çok yakın olduğunu görebiliyoruz ki bu da yine Gini Impurity Karar Ağacı algoritmasının ne kadar iyi çalıştığını ve doğru uygulamış olduğumuzu bize gösteriyor.
Gini algoritmasına göre oluşturulan karar ağacı ayrımında elde edilen gini skoru bize bölünmenin ne kadar iyi olduğuna dair bir fikir veriyor. En iyi ayrımda 0 skorunu elde etmemiz gerekiyor. Buna göre özyinelemeli olarak yazılan ve yukarıda veri setini eğitmek için kullanmış olduğumuz karar ağacı sınıfı aşağıdaki kod parçasında görülebilir.
# dt.py
class DecisionTreeClassifier:
# baslangicta karar agaci derinligini belirleyen constructor
# varsayilan karar agaci derinligi 5
def __init__(self, max_depth=5):
self.root = None
self.max_depth = max_depth
# veri setini gini algoritmasina gore egitir
def fit(self, X, y):
self.root = self.recursive_tree(X, y)
return
# verilere bagli tahmin yapar
def predict(self, X_test):
if isinstance(X_test[0], float):
node = self.root
while node.left:
if X_test[node.feature_index] < node.threshold:
node = node.left
else:
node = node.right
return node.flower
y_test = list()
for element in X_test:
node = self.root
while node.left:
if element[node.feature_index] < node.threshold:
node = node.left
else:
node = node.right
y_test.append(node.flower)
return y_test
# agac derinligine gore gini algoritmasini uygular ve agaci insa eder
def recursive_tree(self, X, y, depth = 0):
best_gini = float("inf")
for index in range(len(X[0])):
# gruplari, siniflari, girdileri olusturur
for for_value in X:
left, right = list(), list()
for i,row in enumerate(X):
if row[index] <= for_value[index]:
left.append((row, y[i]))
else:
right.append((row, y[i]))
groups = [left, right]
classes = list(set(y))
entries = sum([len(group) for group in groups])
gini_value = 0
for group in groups:
local_gini = 1
group_entries = len(group)
if group_entries == 0:
continue
for flower in classes:
local_gini = local_gini - ([entry[-1] for entry in group].count(flower) / group_entries) ** 2
gini_value = gini_value + local_gini * group_entries / entries
if gini_value == 0:
return index, for_value[index], gini_value, groups
if gini_value < best_gini:
best_gini = gini_value
best_index = index
best_value = for_value[index]
left_y = [entry[1] for entry in left]
right_y = [entry[1] for entry in right]
left = [entry[0] for entry in left]
right = [entry[0] for entry in right]
if (best_gini == 0 and len(set(y)) == 1) or depth == self.max_depth:
node = Node(X, y, best_gini)
node.flower = max([(flower, y.count(flower)) for flower in set(y)], key=lambda x : x[1])[0]
return node
node = Node(X, y, best_gini)
node.feature_index = best_index
node.threshold = best_value
node.flower = max([(flower, y.count(flower)) for flower in set(y)], key=lambda x : x[1])[0]
node.left = self.recursive_tree(left, left_y, depth + 1)
node.right = self.recursive_tree(right, right_y, depth + 1)
return node
# isimizi kolaylastirmak icin ekstra bir Node sinifi
class Node:
def __init__(self, X, y, gini):
self.left = None
self.right = None
self.flower = None
self.feature_index = 0
self.threshold = 0
self.X = X
self.y = y
self.gini = gini[3] https://seaborn.pydata.org/generated/seaborn.pairplot.html
[4] https://en.wikipedia.org/wiki/Decision_tree_learning#Gini_impurity
[6] https://developers.google.com/machine-learning/crash-course/classification/roc-and-auc







